What is the 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene?

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is , while it's Molecular Formula is C12H16 Cl2 O. Used in Chemical Synthesis: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a chemical intermediate for the production of various industrial products, such as dyes, pesticides, and pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of these compounds, contributing to their color, efficacy, or therapeutic properties. Used in Solvent Applications: In the chemical industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene also serves as a solvent in certain chemical reactions and processes. Its solubility properties make it suitable for dissolving other compounds and facilitating specific types of chemical transformations. Used in Pharmaceutical Industry: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a building block in the synthesis of pharmaceuticals. Its presence in the molecular structure of some drugs can influence their pharmacological activity, potentially enhancing their effectiveness or modifying their delivery to target tissues. Used in Dye Industry: In the dye industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a precursor to create dyes with specific color characteristics. Its molecular structure contributes to the color intensity and stability of the dyes, making it an important component in the formulation of various colorants. Used in Pesticide Industry: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a component in the development of pesticides. Its chemical properties can be harnessed to enhance the effectiveness of these products, potentially increasing their ability to control pests while minimizing environmental impact. Safety Considerations: As a chlorinated compound, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene requires careful handling and adherence to safety protocols to prevent health hazards. Proper protective equipment and disposal methods should be employed to ensure the safety of workers and the environment.

What is the CAS number for 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene?

The CAS number of 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is 6940-88-1.

What is 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene (6940-88-1) used for?

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is a chlorinated aromatic compound with the molecular formula C12H15Cl2O. It features a benzene ring with two chlorine atoms and a propyl chain that includes a chlorine atom and a methylethoxy group. This versatile chemical intermediate is utilized in the synthesis of a range of industrial products.InChI:InChI=1/C12H16Cl2O/c1-9(2)15-12(7-8-13)10-3-5-11(14)6-4-10/h3-6,9,12H,7-8H2,1-2H3

What is the 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene?

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is , while it's Molecular Formula is C12H16 Cl2 O. Used in Chemical Synthesis: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a chemical intermediate for the production of various industrial products, such as dyes, pesticides, and pharmaceuticals. Its unique structure allows it to be a key component in the synthesis of these compounds, contributing to their color, efficacy, or therapeutic properties. Used in Solvent Applications: In the chemical industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene also serves as a solvent in certain chemical reactions and processes. Its solubility properties make it suitable for dissolving other compounds and facilitating specific types of chemical transformations. Used in Pharmaceutical Industry: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a building block in the synthesis of pharmaceuticals. Its presence in the molecular structure of some drugs can influence their pharmacological activity, potentially enhancing their effectiveness or modifying their delivery to target tissues. Used in Dye Industry: In the dye industry, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a precursor to create dyes with specific color characteristics. Its molecular structure contributes to the color intensity and stability of the dyes, making it an important component in the formulation of various colorants. Used in Pesticide Industry: 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is used as a component in the development of pesticides. Its chemical properties can be harnessed to enhance the effectiveness of these products, potentially increasing their ability to control pests while minimizing environmental impact. Safety Considerations: As a chlorinated compound, 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene requires careful handling and adherence to safety protocols to prevent health hazards. Proper protective equipment and disposal methods should be employed to ensure the safety of workers and the environment.

What is the CAS number for 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene?

The CAS number of 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is 6940-88-1.

What is 1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene (6940-88-1) used for?

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is a chlorinated aromatic compound with the molecular formula C12H15Cl2O. It features a benzene ring with two chlorine atoms and a propyl chain that includes a chlorine atom and a methylethoxy group. This versatile chemical intermediate is utilized in the synthesis of a range of industrial products.InChI:InChI=1/C12H16Cl2O/c1-9(2)15-12(7-8-13)10-3-5-11(14)6-4-10/h3-6,9,12H,7-8H2,1-2H3

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene Good Manufacturer supply High Quality 6940-88-1

Current location:Home > Others

^*Product Name

CasNo

Purity

Quantity



Company name

^*Email

^*Other Description

^*Verification code:

Items marked with^*are mandatory

Submit

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene Good Manufacturer supply High Quality 6940-88-1

Molecular Formula: C12H16 Cl2 O
Molecular Weight: 247.16084
Vapor Pressure: 0.00152mmHg at 25°C
Boiling Point: 305°C at 760 mmHg
Flash Point: 45.7°C
PSA： 9.23000
Density: 1.128g/cm³
LogP: 4.43500

1-chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene(Cas 6940-88-1) Usage

General Description

1-Chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene is a chemical compound with the molecular formula C12H15Cl2O. It is a chlorinated aromatic compound with a benzene ring and two chlorine atoms attached to it. The molecule also contains a propyl chain with a chlorine atom and a methylethoxy group attached to it. This chemical is mainly used as an intermediate in the production of various industrial products, such as dyes, pesticides, and pharmaceuticals. It is also used as a solvent in some chemical reactions and processes. As a chlorinated compound, it is important to handle 1-Chloro-4-[3-chloro-1-(1-methylethoxy)propyl]benzene with caution and follow proper safety protocols to avoid any potential health hazards.

InChI:InChI=1/C12H16Cl2O/c1-9(2)15-12(7-8-13)10-3-5-11(14)6-4-10/h3-6,9,12H,7-8H2,1-2H3